About 3-methyl-6-methylidene-3-propa-1,2-dienylcyclohexa-1,4-diene
3-methyl-6-methylidene-3-propa-1,2-dienylcyclohexa-1,4-diene (PubChem CID 46210916) has the molecular formula C11H12
and a molecular weight of 144.22 g/mol. Its IUPAC name is 3-methyl-6-methylidene-3-propa-1,2-dienylcyclohexa-1,4-diene.
Molecular Properties
| Compound Name | 3-methyl-6-methylidene-3-propa-1,2-dienylcyclohexa-1,4-diene |
| PubChem CID | 46210916 |
| Molecular Formula | C11H12 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 3-methyl-6-methylidene-3-propa-1,2-dienylcyclohexa-1,4-diene |
| SMILES | C=C=CC1(C)C=CC(=C)C=C1 |
| InChI | InChI=1S/C11H12/c1-4-7-11(3)8-5-10(2)6-9-11/h5-9H,1-2H2,3H3 |
| InChIKey | QGLHEYQUQZZZHE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-methyl-6-methylidene-3-propa-1,2-dienylcyclohexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6-methylidene-3-propa-1,2-dienylcyclohexa-1,4-diene?
The IUPAC name of 3-methyl-6-methylidene-3-propa-1,2-dienylcyclohexa-1,4-diene (CID 46210916) is 3-methyl-6-methylidene-3-propa-1,2-dienylcyclohexa-1,4-diene.
What is the SMILES notation for 3-methyl-6-methylidene-3-propa-1,2-dienylcyclohexa-1,4-diene?
The canonical SMILES for 3-methyl-6-methylidene-3-propa-1,2-dienylcyclohexa-1,4-diene is C=C=CC1(C)C=CC(=C)C=C1.
What is the InChIKey of 3-methyl-6-methylidene-3-propa-1,2-dienylcyclohexa-1,4-diene?
The InChIKey is QGLHEYQUQZZZHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12/c1-4-7-11(3)8-5-10(2)6-9-11/h5-9H,1-2H2,3H3.
What are the key properties of 3-methyl-6-methylidene-3-propa-1,2-dienylcyclohexa-1,4-diene?
3-methyl-6-methylidene-3-propa-1,2-dienylcyclohexa-1,4-diene has a molecular weight of 144.22 g/mol, XLogP of 3.02, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6-methylidene-3-propa-1,2-dienylcyclohexa-1,4-diene is sourced from PubChem (CID 46210916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).