C21H32O8 — CID 46211050
(2R,3R,4S,7S)-3-[(3R,4R)-3,4-dihydroxypentanoyl]oxy-7-(3-hydroxyphenyl)-7-methoxy-2,4-dimethylheptanoic acid (PubChem CID 46211050) has the molecular formula C21H32O8 and a molecular weight of 412.48 g/mol. Its IUPAC name is (2R,3R,4S,7S)-3-[(3R,4R)-3,4-dihydroxypentanoyl]oxy-7-(3-hydroxyphenyl)-7-methoxy-2,4-dimethylheptanoic acid.
| Compound Name | (2R,3R,4S,7S)-3-[(3R,4R)-3,4-dihydroxypentanoyl]oxy-7-(3-hydroxyphenyl)-7-methoxy-2,4-dimethylheptanoic acid |
|---|---|
| PubChem CID | 46211050 |
| Molecular Formula | C21H32O8 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | (2R,3R,4S,7S)-3-[(3R,4R)-3,4-dihydroxypentanoyl]oxy-7-(3-hydroxyphenyl)-7-methoxy-2,4-dimethylheptanoic acid |
| SMILES | CO[C@@H](CC[C@H](C)[C@@H](OC(=O)C[C@@H](O)[C@@H](C)O)[C@@H](C)C(=O)O)c1cccc(O)c1 |
| InChI | InChI=1S/C21H32O8/c1-12(8-9-18(28-4)15-6-5-7-16(23)10-15)20(13(2)21(26)27)29-19(25)11-17(24)14(3)22/h5-7,10,12-14,17-18,20,22-24H,8-9,11H2,1-4H3,(H,26,27)/t12-,13+,14+,17+,18-,20+/m0/s1 |
| InChIKey | SDQFZZGLPYJDFO-IKZAZAHWSA-N |
| XLogP | 2.26 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |