C10H13ClF6N2O2 — CID 4621111
4-chloro-2,2,3,3,4,4-hexafluoro-N-(2-morpholin-4-ylethyl)butanamide (PubChem CID 4621111) has the molecular formula C10H13ClF6N2O2 and a molecular weight of 342.67 g/mol. Its IUPAC name is 4-chloro-2,2,3,3,4,4-hexafluoro-N-(2-morpholin-4-ylethyl)butanamide.
| Compound Name | 4-chloro-2,2,3,3,4,4-hexafluoro-N-(2-morpholin-4-ylethyl)butanamide |
|---|---|
| PubChem CID | 4621111 |
| Molecular Formula | C10H13ClF6N2O2 |
| Molecular Weight | 342.67 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 4-chloro-2,2,3,3,4,4-hexafluoro-N-(2-morpholin-4-ylethyl)butanamide |
| SMILES | O=C(NCCN1CCOCC1)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C10H13ClF6N2O2/c11-10(16,17)9(14,15)8(12,13)7(20)18-1-2-19-3-5-21-6-4-19/h1-6H2,(H,18,20) |
| InChIKey | BSBHEYVHSJMBTH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.67 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|