About (1R,2S)-1-(2,6-dimethylphenyl)sulfanyl-3-methoxy-1-phenylpropan-2-ol
(1R,2S)-1-(2,6-dimethylphenyl)sulfanyl-3-methoxy-1-phenylpropan-2-ol (PubChem CID 46211220) has the molecular formula C18H22O2S
and a molecular weight of 302.44 g/mol. Its IUPAC name is (1R,2S)-1-(2,6-dimethylphenyl)sulfanyl-3-methoxy-1-phenylpropan-2-ol.
Molecular Properties
| Compound Name | (1R,2S)-1-(2,6-dimethylphenyl)sulfanyl-3-methoxy-1-phenylpropan-2-ol |
| PubChem CID | 46211220 |
| Molecular Formula | C18H22O2S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (1R,2S)-1-(2,6-dimethylphenyl)sulfanyl-3-methoxy-1-phenylpropan-2-ol |
| SMILES | COC[C@H](O)[C@H](Sc1c(C)cccc1C)c1ccccc1 |
| InChI | InChI=1S/C18H22O2S/c1-13-8-7-9-14(2)17(13)21-18(16(19)12-20-3)15-10-5-4-6-11-15/h4-11,16,18-19H,12H2,1-3H3/t16-,18+/m0/s1 |
| InChIKey | YSVZSNPABSWCSC-FUHWJXTLSA-N |
| XLogP | 4.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R,2S)-1-(2,6-dimethylphenyl)sulfanyl-3-methoxy-1-phenylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2S)-1-(2,6-dimethylphenyl)sulfanyl-3-methoxy-1-phenylpropan-2-ol?
The IUPAC name of (1R,2S)-1-(2,6-dimethylphenyl)sulfanyl-3-methoxy-1-phenylpropan-2-ol (CID 46211220) is (1R,2S)-1-(2,6-dimethylphenyl)sulfanyl-3-methoxy-1-phenylpropan-2-ol.
What is the SMILES notation for (1R,2S)-1-(2,6-dimethylphenyl)sulfanyl-3-methoxy-1-phenylpropan-2-ol?
The canonical SMILES for (1R,2S)-1-(2,6-dimethylphenyl)sulfanyl-3-methoxy-1-phenylpropan-2-ol is COC[C@H](O)[C@H](Sc1c(C)cccc1C)c1ccccc1.
What is the InChIKey of (1R,2S)-1-(2,6-dimethylphenyl)sulfanyl-3-methoxy-1-phenylpropan-2-ol?
The InChIKey is YSVZSNPABSWCSC-FUHWJXTLSA-N. The full InChI is InChI=1S/C18H22O2S/c1-13-8-7-9-14(2)17(13)21-18(16(19)12-20-3)15-10-5-4-6-11-15/h4-11,16,18-19H,12H2,1-3H3/t16-,18+/m0/s1.
What are the key properties of (1R,2S)-1-(2,6-dimethylphenyl)sulfanyl-3-methoxy-1-phenylpropan-2-ol?
(1R,2S)-1-(2,6-dimethylphenyl)sulfanyl-3-methoxy-1-phenylpropan-2-ol has a molecular weight of 302.44 g/mol, XLogP of 4.14, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2S)-1-(2,6-dimethylphenyl)sulfanyl-3-methoxy-1-phenylpropan-2-ol is sourced from PubChem (CID 46211220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).