C10H9ClF3NO — CID 4621125
N-[2-(3-chlorophenyl)ethyl]-2,2,2-trifluoroacetamide (PubChem CID 4621125) has the molecular formula C10H9ClF3NO and a molecular weight of 251.63 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 4621125 |
| Molecular Formula | C10H9ClF3NO |
| Molecular Weight | 251.63 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(NCCc1cccc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C10H9ClF3NO/c11-8-3-1-2-7(6-8)4-5-15-9(16)10(12,13)14/h1-3,6H,4-5H2,(H,15,16) |
| InChIKey | OYPHHKYAFSEGNV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.63 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |