About 4,5-dimethoxyphenanthrene-2,9-diol
4,5-dimethoxyphenanthrene-2,9-diol (PubChem CID 46211446) has the molecular formula C16H14O4
and a molecular weight of 270.28 g/mol. Its IUPAC name is 4,5-dimethoxyphenanthrene-2,9-diol.
Molecular Properties
| Compound Name | 4,5-dimethoxyphenanthrene-2,9-diol |
| PubChem CID | 46211446 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 4,5-dimethoxyphenanthrene-2,9-diol |
| SMILES | COc1cc(O)cc2cc(O)c3cccc(OC)c3c12 |
| InChI | InChI=1S/C16H14O4/c1-19-13-5-3-4-11-12(18)7-9-6-10(17)8-14(20-2)15(9)16(11)13/h3-8,17-18H,1-2H3 |
| InChIKey | LXWFKQGQNDDVAL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethoxyphenanthrene-2,9-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethoxyphenanthrene-2,9-diol?
The IUPAC name of 4,5-dimethoxyphenanthrene-2,9-diol (CID 46211446) is 4,5-dimethoxyphenanthrene-2,9-diol.
What is the SMILES notation for 4,5-dimethoxyphenanthrene-2,9-diol?
The canonical SMILES for 4,5-dimethoxyphenanthrene-2,9-diol is COc1cc(O)cc2cc(O)c3cccc(OC)c3c12.
What is the InChIKey of 4,5-dimethoxyphenanthrene-2,9-diol?
The InChIKey is LXWFKQGQNDDVAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O4/c1-19-13-5-3-4-11-12(18)7-9-6-10(17)8-14(20-2)15(9)16(11)13/h3-8,17-18H,1-2H3.
What are the key properties of 4,5-dimethoxyphenanthrene-2,9-diol?
4,5-dimethoxyphenanthrene-2,9-diol has a molecular weight of 270.28 g/mol, XLogP of 3.42, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethoxyphenanthrene-2,9-diol is sourced from PubChem (CID 46211446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).