C25H22O6 — CID 46211447
(2S,3R)-2-(4-hydroxy-3-methoxyphenyl)-11-methoxy-3,4-dihydro-2H-naphtho[2,1-f]chromene-3,10-diol (PubChem CID 46211447) has the molecular formula C25H22O6 and a molecular weight of 418.45 g/mol. Its IUPAC name is (2S,3R)-2-(4-hydroxy-3-methoxyphenyl)-11-methoxy-3,4-dihydro-2H-naphtho[2,1-f]chromene-3,10-diol.
| Compound Name | (2S,3R)-2-(4-hydroxy-3-methoxyphenyl)-11-methoxy-3,4-dihydro-2H-naphtho[2,1-f]chromene-3,10-diol |
|---|---|
| PubChem CID | 46211447 |
| Molecular Formula | C25H22O6 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | (2S,3R)-2-(4-hydroxy-3-methoxyphenyl)-11-methoxy-3,4-dihydro-2H-naphtho[2,1-f]chromene-3,10-diol |
| SMILES | COc1cc([C@@H]2Oc3cc(OC)c4c(ccc5cccc(O)c54)c3C[C@H]2O)ccc1O |
| InChI | InChI=1S/C25H22O6/c1-29-21-10-14(7-9-17(21)26)25-19(28)11-16-15-8-6-13-4-3-5-18(27)23(13)24(15)22(30-2)12-20(16)31-25/h3-10,12,19,25-28H,11H2,1-2H3/t19-,25+/m1/s1 |
| InChIKey | DCCJOXUWPQSOJV-CLOONOSVSA-N |
| XLogP | 4.46 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|