C25H31N3O4 — CID 46211602
(4S)-4-(4-hydroxyphenyl)-9-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-1,5,9-triazacyclotridecan-2-one (PubChem CID 46211602) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is (4S)-4-(4-hydroxyphenyl)-9-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-1,5,9-triazacyclotridecan-2-one.
| Compound Name | (4S)-4-(4-hydroxyphenyl)-9-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-1,5,9-triazacyclotridecan-2-one |
|---|---|
| PubChem CID | 46211602 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | (4S)-4-(4-hydroxyphenyl)-9-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]-1,5,9-triazacyclotridecan-2-one |
| SMILES | O=C1C[C@@H](c2ccc(O)cc2)NCCCN(C(=O)/C=C/c2ccc(O)cc2)CCCCN1 |
| InChI | InChI=1S/C25H31N3O4/c29-21-9-4-19(5-10-21)6-13-25(32)28-16-2-1-14-27-24(31)18-23(26-15-3-17-28)20-7-11-22(30)12-8-20/h4-13,23,26,29-30H,1-3,14-18H2,(H,27,31)/b13-6+/t23-/m0/s1 |
| InChIKey | APTGQAOJVZBXPO-APYIBEOOSA-N |
| XLogP | 2.96 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|