C32H60O6 — CID 46211780
(3R,6S,9R,12S)-6,12-bis(hydroxymethyl)-3,9-dimethyl-6,12-di(nonyl)-1,7-dioxacyclododecane-2,8-dione (PubChem CID 46211780) has the molecular formula C32H60O6 and a molecular weight of 540.83 g/mol. Its IUPAC name is (3R,6S,9R,12S)-6,12-bis(hydroxymethyl)-3,9-dimethyl-6,12-di(nonyl)-1,7-dioxacyclododecane-2,8-dione.
| Compound Name | (3R,6S,9R,12S)-6,12-bis(hydroxymethyl)-3,9-dimethyl-6,12-di(nonyl)-1,7-dioxacyclododecane-2,8-dione |
|---|---|
| PubChem CID | 46211780 |
| Molecular Formula | C32H60O6 |
| Molecular Weight | 540.83 g/mol |
| Exact Mass | 540.44 |
| IUPAC Name | (3R,6S,9R,12S)-6,12-bis(hydroxymethyl)-3,9-dimethyl-6,12-di(nonyl)-1,7-dioxacyclododecane-2,8-dione |
| SMILES | CCCCCCCCC[C@@]1(CO)CC[C@@H](C)C(=O)O[C@@](CO)(CCCCCCCCC)CC[C@@H](C)C(=O)O1 |
| InChI | InChI=1S/C32H60O6/c1-5-7-9-11-13-15-17-21-31(25-33)23-19-27(3)30(36)38-32(26-34,24-20-28(4)29(35)37-31)22-18-16-14-12-10-8-6-2/h27-28,33-34H,5-26H2,1-4H3/t27-,28-,31+,32+/m1/s1 |
| InChIKey | YUKFGKYWDWLMAR-CKROWEISSA-N |
| XLogP | 7.66 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.83 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|