About 2-chloro-6-hydroxy-4H-furo[3,2-b]pyridin-5-one
2-chloro-6-hydroxy-4H-furo[3,2-b]pyridin-5-one (PubChem CID 46211991) has the molecular formula C7H4ClNO3
and a molecular weight of 185.57 g/mol. Its IUPAC name is 2-chloro-6-hydroxy-4H-furo[3,2-b]pyridin-5-one.
Molecular Properties
| Compound Name | 2-chloro-6-hydroxy-4H-furo[3,2-b]pyridin-5-one |
| PubChem CID | 46211991 |
| Molecular Formula | C7H4ClNO3 |
| Molecular Weight | 185.57 g/mol |
| Exact Mass | 184.99 |
| IUPAC Name | 2-chloro-6-hydroxy-4H-furo[3,2-b]pyridin-5-one |
| SMILES | O=c1[nH]c2cc(Cl)oc2cc1O |
| InChI | InChI=1S/C7H4ClNO3/c8-6-1-3-5(12-6)2-4(10)7(11)9-3/h1-2,10H,(H,9,11) |
| InChIKey | WSDOZJRLWPKXTG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.57 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-6-hydroxy-4H-furo[3,2-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-hydroxy-4H-furo[3,2-b]pyridin-5-one?
The IUPAC name of 2-chloro-6-hydroxy-4H-furo[3,2-b]pyridin-5-one (CID 46211991) is 2-chloro-6-hydroxy-4H-furo[3,2-b]pyridin-5-one.
What is the SMILES notation for 2-chloro-6-hydroxy-4H-furo[3,2-b]pyridin-5-one?
The canonical SMILES for 2-chloro-6-hydroxy-4H-furo[3,2-b]pyridin-5-one is O=c1[nH]c2cc(Cl)oc2cc1O.
What is the InChIKey of 2-chloro-6-hydroxy-4H-furo[3,2-b]pyridin-5-one?
The InChIKey is WSDOZJRLWPKXTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClNO3/c8-6-1-3-5(12-6)2-4(10)7(11)9-3/h1-2,10H,(H,9,11).
What are the key properties of 2-chloro-6-hydroxy-4H-furo[3,2-b]pyridin-5-one?
2-chloro-6-hydroxy-4H-furo[3,2-b]pyridin-5-one has a molecular weight of 185.57 g/mol, XLogP of 1.48, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-hydroxy-4H-furo[3,2-b]pyridin-5-one is sourced from PubChem (CID 46211991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).