C19H13ClF3N5O2 — CID 46212488
5-[1-[(6-chloro-3-pyridinyl)methyl]-5-methylpyrazol-3-yl]-3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole (PubChem CID 46212488) has the molecular formula C19H13ClF3N5O2 and a molecular weight of 435.79 g/mol. Its IUPAC name is 5-[1-[(6-chloro-3-pyridinyl)methyl]-5-methylpyrazol-3-yl]-3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole.
| Compound Name | 5-[1-[(6-chloro-3-pyridinyl)methyl]-5-methylpyrazol-3-yl]-3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 46212488 |
| Molecular Formula | C19H13ClF3N5O2 |
| Molecular Weight | 435.79 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | 5-[1-[(6-chloro-3-pyridinyl)methyl]-5-methylpyrazol-3-yl]-3-[4-(trifluoromethoxy)phenyl]-1,2,4-oxadiazole |
| SMILES | Cc1cc(-c2nc(-c3ccc(OC(F)(F)F)cc3)no2)nn1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C19H13ClF3N5O2/c1-11-8-15(26-28(11)10-12-2-7-16(20)24-9-12)18-25-17(27-30-18)13-3-5-14(6-4-13)29-19(21,22)23/h2-9H,10H2,1H3 |
| InChIKey | ACUIBVQSGWRYEI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 78.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.79 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|