C26H27F3N8O5 — CID 46212589
N-[6-[4-[(2-nitrophenyl)carbamoyl]piperazin-1-yl]-3-pyridinyl]-2-piperidin-1-yl-4-(trifluoromethyl)-1,3-oxazole-5-carboxamide (PubChem CID 46212589) has the molecular formula C26H27F3N8O5 and a molecular weight of 588.55 g/mol. Its IUPAC name is N-[6-[4-[(2-nitrophenyl)carbamoyl]piperazin-1-yl]-3-pyridinyl]-2-piperidin-1-yl-4-(trifluoromethyl)-1,3-oxazole-5-carboxamide.
| Compound Name | N-[6-[4-[(2-nitrophenyl)carbamoyl]piperazin-1-yl]-3-pyridinyl]-2-piperidin-1-yl-4-(trifluoromethyl)-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 46212589 |
| Molecular Formula | C26H27F3N8O5 |
| Molecular Weight | 588.55 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | N-[6-[4-[(2-nitrophenyl)carbamoyl]piperazin-1-yl]-3-pyridinyl]-2-piperidin-1-yl-4-(trifluoromethyl)-1,3-oxazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)Nc3ccccc3[N+](=O)[O-])CC2)nc1)c1oc(N2CCCCC2)nc1C(F)(F)F |
| InChI | InChI=1S/C26H27F3N8O5/c27-26(28,29)22-21(42-25(33-22)36-10-4-1-5-11-36)23(38)31-17-8-9-20(30-16-17)34-12-14-35(15-13-34)24(39)32-18-6-2-3-7-19(18)37(40)41/h2-3,6-9,16H,1,4-5,10-15H2,(H,31,38)(H,32,39) |
| InChIKey | QJRKPFJLYONYQF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 149.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.55 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|