C20H30O3 — CID 46212697
5,10,17,17-tetramethyl-14-methylidene-4,9-dioxatetracyclo[11.3.1.03,5.08,10]heptadecan-15-one (PubChem CID 46212697) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is 5,10,17,17-tetramethyl-14-methylidene-4,9-dioxatetracyclo[11.3.1.03,5.08,10]heptadecan-15-one.
| Compound Name | 5,10,17,17-tetramethyl-14-methylidene-4,9-dioxatetracyclo[11.3.1.03,5.08,10]heptadecan-15-one |
|---|---|
| PubChem CID | 46212697 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 5,10,17,17-tetramethyl-14-methylidene-4,9-dioxatetracyclo[11.3.1.03,5.08,10]heptadecan-15-one |
| SMILES | C=C1C(=O)CC2CC3OC3(C)CCC3OC3(C)CCC1C2(C)C |
| InChI | InChI=1S/C20H30O3/c1-12-14-6-8-19(4)16(22-19)7-9-20(5)17(23-20)11-13(10-15(12)21)18(14,2)3/h13-14,16-17H,1,6-11H2,2-5H3 |
| InChIKey | NQFJPRWQSYJXBY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 42.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|