About Phenylpropylamine derivative 3
Phenylpropylamine derivative 3 (PubChem CID 46212857) has the molecular formula C17H28N2O2
and a molecular weight of 292.40 g/mol. Its IUPAC name is N-butyl-N-[3-(4-nitrophenyl)propyl]butan-1-amine.
Molecular Properties
| Compound Name | Phenylpropylamine derivative 3 |
| PubChem CID | 46212857 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | N-butyl-N-[3-(4-nitrophenyl)propyl]butan-1-amine |
| SMILES | CCCCN(CCCC)CCCC1=CC=C(C=C1)[N+](=O)[O-] |
| InChI | InChI=1S/C17H28N2O2/c1-3-5-13-18(14-6-4-2)15-7-8-16-9-11-17(12-10-16)19(20)21/h9-12H,3-8,13-15H2,1-2H3 |
| InChIKey | RQYGHCATHJZLFY-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 49.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | 262 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze Phenylpropylamine derivative 3 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Phenylpropylamine derivative 3?
The IUPAC name of Phenylpropylamine derivative 3 (CID 46212857) is N-butyl-N-[3-(4-nitrophenyl)propyl]butan-1-amine.
What is the SMILES notation for Phenylpropylamine derivative 3?
The canonical SMILES for Phenylpropylamine derivative 3 is CCCCN(CCCC)CCCC1=CC=C(C=C1)[N+](=O)[O-].
What is the InChIKey of Phenylpropylamine derivative 3?
The InChIKey is RQYGHCATHJZLFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2O2/c1-3-5-13-18(14-6-4-2)15-7-8-16-9-11-17(12-10-16)19(20)21/h9-12H,3-8,13-15H2,1-2H3.
What are the key properties of Phenylpropylamine derivative 3?
Phenylpropylamine derivative 3 has a molecular weight of 292.40 g/mol, XLogP of 4.90, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Phenylpropylamine derivative 3 is sourced from PubChem (CID 46212857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).