C30H32FN5O2S — CID 46212908
(E)-4-(dimethylamino)-1-[3-[[(1S)-2-[(3-fluorophenyl)methoxy]-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one (PubChem CID 46212908) has the molecular formula C30H32FN5O2S and a molecular weight of 545.68 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-1-[3-[[(1S)-2-[(3-fluorophenyl)methoxy]-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one.
| Compound Name | (E)-4-(dimethylamino)-1-[3-[[(1S)-2-[(3-fluorophenyl)methoxy]-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 46212908 |
| Molecular Formula | C30H32FN5O2S |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | (E)-4-(dimethylamino)-1-[3-[[(1S)-2-[(3-fluorophenyl)methoxy]-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
| SMILES | CN(C)C/C=C/C(=O)N1CCc2c(sc3ncnc(N[C@H](COCc4cccc(F)c4)c4ccccc4)c23)C1 |
| InChI | InChI=1S/C30H32FN5O2S/c1-35(2)14-7-12-27(37)36-15-13-24-26(17-36)39-30-28(24)29(32-20-33-30)34-25(22-9-4-3-5-10-22)19-38-18-21-8-6-11-23(31)16-21/h3-12,16,20,25H,13-15,17-19H2,1-2H3,(H,32,33,34)/b12-7+/t25-/m1/s1 |
| InChIKey | UBYWEXFKSRHKAS-VISBSAOHSA-N |
| XLogP | 5.20 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|