About (5R)-5-hydroxy-1,7-diphenylheptan-3-one
(5R)-5-hydroxy-1,7-diphenylheptan-3-one (PubChem CID 46213118) has the molecular formula C19H22O2
and a molecular weight of 282.38 g/mol. Its IUPAC name is (5R)-5-hydroxy-1,7-diphenylheptan-3-one.
Molecular Properties
| Compound Name | (5R)-5-hydroxy-1,7-diphenylheptan-3-one |
| PubChem CID | 46213118 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (5R)-5-hydroxy-1,7-diphenylheptan-3-one |
| SMILES | O=C(CCc1ccccc1)C[C@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C19H22O2/c20-18(13-11-16-7-3-1-4-8-16)15-19(21)14-12-17-9-5-2-6-10-17/h1-10,18,20H,11-15H2/t18-/m1/s1 |
| InChIKey | CCNKTMMNRPJQHV-GOSISDBHSA-N |
| XLogP | 3.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-5-hydroxy-1,7-diphenylheptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-hydroxy-1,7-diphenylheptan-3-one?
The IUPAC name of (5R)-5-hydroxy-1,7-diphenylheptan-3-one (CID 46213118) is (5R)-5-hydroxy-1,7-diphenylheptan-3-one.
What is the SMILES notation for (5R)-5-hydroxy-1,7-diphenylheptan-3-one?
The canonical SMILES for (5R)-5-hydroxy-1,7-diphenylheptan-3-one is O=C(CCc1ccccc1)C[C@H](O)CCc1ccccc1.
What is the InChIKey of (5R)-5-hydroxy-1,7-diphenylheptan-3-one?
The InChIKey is CCNKTMMNRPJQHV-GOSISDBHSA-N. The full InChI is InChI=1S/C19H22O2/c20-18(13-11-16-7-3-1-4-8-16)15-19(21)14-12-17-9-5-2-6-10-17/h1-10,18,20H,11-15H2/t18-/m1/s1.
What are the key properties of (5R)-5-hydroxy-1,7-diphenylheptan-3-one?
(5R)-5-hydroxy-1,7-diphenylheptan-3-one has a molecular weight of 282.38 g/mol, XLogP of 3.57, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-hydroxy-1,7-diphenylheptan-3-one is sourced from PubChem (CID 46213118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).