C25H30ClN5O — CID 46213247
8-chloro-1-(4-propan-2-yloxycyclohexyl)-5-(pyridin-2-ylmethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (PubChem CID 46213247) has the molecular formula C25H30ClN5O and a molecular weight of 452.00 g/mol. Its IUPAC name is 8-chloro-1-(4-propan-2-yloxycyclohexyl)-5-(pyridin-2-ylmethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine.
| Compound Name | 8-chloro-1-(4-propan-2-yloxycyclohexyl)-5-(pyridin-2-ylmethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 46213247 |
| Molecular Formula | C25H30ClN5O |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 8-chloro-1-(4-propan-2-yloxycyclohexyl)-5-(pyridin-2-ylmethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| SMILES | CC(C)OC1CCC(c2nnc3n2-c2ccc(Cl)cc2CN(Cc2ccccn2)C3)CC1 |
| InChI | InChI=1S/C25H30ClN5O/c1-17(2)32-22-9-6-18(7-10-22)25-29-28-24-16-30(15-21-5-3-4-12-27-21)14-19-13-20(26)8-11-23(19)31(24)25/h3-5,8,11-13,17-18,22H,6-7,9-10,14-16H2,1-2H3 |
| InChIKey | HWZMJWUHAJZWOY-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |