C27H34N2O — CID 46213429
N-[(3aS,4S,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-1-phenylcyclohexane-1-carboxamide (PubChem CID 46213429) has the molecular formula C27H34N2O and a molecular weight of 402.58 g/mol. Its IUPAC name is N-[(3aS,4S,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-1-phenylcyclohexane-1-carboxamide.
| Compound Name | N-[(3aS,4S,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-1-phenylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 46213429 |
| Molecular Formula | C27H34N2O |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | N-[(3aS,4S,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-1-phenylcyclohexane-1-carboxamide |
| SMILES | O=C(N[C@H]1CC[C@H]2CN(Cc3ccccc3)C[C@H]21)C1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C27H34N2O/c30-26(27(16-8-3-9-17-27)23-12-6-2-7-13-23)28-25-15-14-22-19-29(20-24(22)25)18-21-10-4-1-5-11-21/h1-2,4-7,10-13,22,24-25H,3,8-9,14-20H2,(H,28,30)/t22-,24+,25-/m0/s1 |
| InChIKey | NWOTVJCUJHEELF-CAOCKLPOSA-N |
| XLogP | 4.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |