C30H46N4O4S — CID 46213527
tert-butyl N-[(E,2R,5R)-3,5-dimethyl-6-[[(2S)-4-methyl-1-[(6-methyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]-1-oxopentan-2-yl]amino]-6-oxo-1-phenylhex-3-en-2-yl]carbamate (PubChem CID 46213527) has the molecular formula C30H46N4O4S and a molecular weight of 558.79 g/mol. Its IUPAC name is tert-butyl N-[(E,2R,5R)-3,5-dimethyl-6-[[(2S)-4-methyl-1-[(6-methyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]-1-oxopentan-2-yl]amino]-6-oxo-1-phenylhex-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E,2R,5R)-3,5-dimethyl-6-[[(2S)-4-methyl-1-[(6-methyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]-1-oxopentan-2-yl]amino]-6-oxo-1-phenylhex-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 46213527 |
| Molecular Formula | C30H46N4O4S |
| Molecular Weight | 558.79 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | tert-butyl N-[(E,2R,5R)-3,5-dimethyl-6-[[(2S)-4-methyl-1-[(6-methyl-5,6-dihydro-4H-1,3-thiazin-2-yl)amino]-1-oxopentan-2-yl]amino]-6-oxo-1-phenylhex-3-en-2-yl]carbamate |
| SMILES | C/C(=C\[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)NC1=NCCC(C)S1)[C@@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H46N4O4S/c1-19(2)16-25(27(36)34-28-31-15-14-22(5)39-28)32-26(35)21(4)17-20(3)24(18-23-12-10-9-11-13-23)33-29(37)38-30(6,7)8/h9-13,17,19,21-22,24-25H,14-16,18H2,1-8H3,(H,32,35)(H,33,37)(H,31,34,36)/b20-17+/t21-,22?,24-,25+/m1/s1 |
| InChIKey | AHYHFVJNZUIJSA-CQMOAEOMSA-N |
| XLogP | 5.23 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.79 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|