C30H28ClFN2O6 — CID 4621353
8-(3-chloro-4-fluorophenyl)-2-ethyl-6-(2-hydroxy-4-methoxyphenyl)-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4621353) has the molecular formula C30H28ClFN2O6 and a molecular weight of 567.01 g/mol. Its IUPAC name is 8-(3-chloro-4-fluorophenyl)-2-ethyl-6-(2-hydroxy-4-methoxyphenyl)-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(3-chloro-4-fluorophenyl)-2-ethyl-6-(2-hydroxy-4-methoxyphenyl)-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4621353 |
| Molecular Formula | C30H28ClFN2O6 |
| Molecular Weight | 567.01 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | 8-(3-chloro-4-fluorophenyl)-2-ethyl-6-(2-hydroxy-4-methoxyphenyl)-6a-methyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CCN1C(=O)C2CC=C3C(CC4C(=O)N(c5ccc(F)c(Cl)c5)C(=O)C4(C)C3c3ccc(OC)cc3O)C2C1=O |
| InChI | InChI=1S/C30H28ClFN2O6/c1-4-33-26(36)18-9-8-16-19(24(18)28(33)38)13-20-27(37)34(14-5-10-22(32)21(31)11-14)29(39)30(20,2)25(16)17-7-6-15(40-3)12-23(17)35/h5-8,10-12,18-20,24-25,35H,4,9,13H2,1-3H3 |
| InChIKey | MVTKVRMMCXGJPH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.01 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|