C23H24ClN5S — CID 46213797
1'-(8-chloro-5-methyl-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)spiro[1H-2-benzothiophene-3,4'-piperidine] (PubChem CID 46213797) has the molecular formula C23H24ClN5S and a molecular weight of 438.00 g/mol. Its IUPAC name is 1'-(8-chloro-5-methyl-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)spiro[1H-2-benzothiophene-3,4'-piperidine].
| Compound Name | 1'-(8-chloro-5-methyl-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)spiro[1H-2-benzothiophene-3,4'-piperidine] |
|---|---|
| PubChem CID | 46213797 |
| Molecular Formula | C23H24ClN5S |
| Molecular Weight | 438.00 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 1'-(8-chloro-5-methyl-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)spiro[1H-2-benzothiophene-3,4'-piperidine] |
| SMILES | CN1Cc2cc(Cl)ccc2-n2c(nnc2N2CCC3(CC2)SCc2ccccc23)C1 |
| InChI | InChI=1S/C23H24ClN5S/c1-27-13-17-12-18(24)6-7-20(17)29-21(14-27)25-26-22(29)28-10-8-23(9-11-28)19-5-3-2-4-16(19)15-30-23/h2-7,12H,8-11,13-15H2,1H3 |
| InChIKey | NYVBKFPUZISLLM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.00 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |