C24H32NaO4+ — CID 46213958
sodium (3'aR,6'aS)-2'-(2,6-diethyl-4-methylphenyl)-4,6-dimethylspiro[1,3-dioxane-2,5'-3a,4,6,6a-tetrahydropentalene]-1',3'-dione (PubChem CID 46213958) has the molecular formula C24H32NaO4+ and a molecular weight of 407.51 g/mol. Its IUPAC name is sodium (3'aR,6'aS)-2'-(2,6-diethyl-4-methylphenyl)-4,6-dimethylspiro[1,3-dioxane-2,5'-3a,4,6,6a-tetrahydropentalene]-1',3'-dione.
| Compound Name | sodium (3'aR,6'aS)-2'-(2,6-diethyl-4-methylphenyl)-4,6-dimethylspiro[1,3-dioxane-2,5'-3a,4,6,6a-tetrahydropentalene]-1',3'-dione |
|---|---|
| PubChem CID | 46213958 |
| Molecular Formula | C24H32NaO4+ |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | sodium (3'aR,6'aS)-2'-(2,6-diethyl-4-methylphenyl)-4,6-dimethylspiro[1,3-dioxane-2,5'-3a,4,6,6a-tetrahydropentalene]-1',3'-dione |
| SMILES | CCc1cc(C)cc(CC)c1C1C(=O)[C@H]2CC3(C[C@H]2C1=O)OC(C)CC(C)O3.[Na+] |
| InChI | InChI=1S/C24H32O4.Na/c1-6-16-8-13(3)9-17(7-2)20(16)21-22(25)18-11-24(12-19(18)23(21)26)27-14(4)10-15(5)28-24;/h8-9,14-15,18-19,21H,6-7,10-12H2,1-5H3;/q;+1/t14?,15?,18-,19+,21?,24?; |
| InChIKey | DWRPNPIFFFJZCZ-AKEGLFKLSA-N |
| XLogP | 1.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|