C25H22F3N3O3 — CID 46214180
(10E)-10-[[3-methoxy-4-(1,2-oxazol-4-yl)phenyl]methylidene]-5-(3,4,5-trifluorophenyl)-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepine (PubChem CID 46214180) has the molecular formula C25H22F3N3O3 and a molecular weight of 469.46 g/mol. Its IUPAC name is (10E)-10-[[3-methoxy-4-(1,2-oxazol-4-yl)phenyl]methylidene]-5-(3,4,5-trifluorophenyl)-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepine.
| Compound Name | (10E)-10-[[3-methoxy-4-(1,2-oxazol-4-yl)phenyl]methylidene]-5-(3,4,5-trifluorophenyl)-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepine |
|---|---|
| PubChem CID | 46214180 |
| Molecular Formula | C25H22F3N3O3 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | (10E)-10-[[3-methoxy-4-(1,2-oxazol-4-yl)phenyl]methylidene]-5-(3,4,5-trifluorophenyl)-3,4,5,7,8,9-hexahydropyrido[2,1-c][1,2,4]oxadiazepine |
| SMILES | COc1cc(/C=C2\CCCN3C2=NOCCC3c2cc(F)c(F)c(F)c2)ccc1-c1cnoc1 |
| InChI | InChI=1S/C25H22F3N3O3/c1-32-23-10-15(4-5-19(23)18-13-29-34-14-18)9-16-3-2-7-31-22(6-8-33-30-25(16)31)17-11-20(26)24(28)21(27)12-17/h4-5,9-14,22H,2-3,6-8H2,1H3/b16-9+ |
| InChIKey | AOYQDJPXWYXZLV-CXUHLZMHSA-N |
| XLogP | 5.72 |
| TPSA | 60.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|