About 4-(2,4-dihydroxyphenyl)-N-(3-fluorophenyl)piperidine-1-carboxamide
4-(2,4-dihydroxyphenyl)-N-(3-fluorophenyl)piperidine-1-carboxamide (PubChem CID 46214377) has the molecular formula C18H19FN2O3
and a molecular weight of 330.36 g/mol. Its IUPAC name is 4-(2,4-dihydroxyphenyl)-N-(3-fluorophenyl)piperidine-1-carboxamide.
Molecular Properties
| Compound Name | 4-(2,4-dihydroxyphenyl)-N-(3-fluorophenyl)piperidine-1-carboxamide |
| PubChem CID | 46214377 |
| Molecular Formula | C18H19FN2O3 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 4-(2,4-dihydroxyphenyl)-N-(3-fluorophenyl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)N1CCC(c2ccc(O)cc2O)CC1 |
| InChI | InChI=1S/C18H19FN2O3/c19-13-2-1-3-14(10-13)20-18(24)21-8-6-12(7-9-21)16-5-4-15(22)11-17(16)23/h1-5,10-12,22-23H,6-9H2,(H,20,24) |
| InChIKey | VEOFCJYACUJIQM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,4-dihydroxyphenyl)-N-(3-fluorophenyl)piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dihydroxyphenyl)-N-(3-fluorophenyl)piperidine-1-carboxamide?
The IUPAC name of 4-(2,4-dihydroxyphenyl)-N-(3-fluorophenyl)piperidine-1-carboxamide (CID 46214377) is 4-(2,4-dihydroxyphenyl)-N-(3-fluorophenyl)piperidine-1-carboxamide.
What is the SMILES notation for 4-(2,4-dihydroxyphenyl)-N-(3-fluorophenyl)piperidine-1-carboxamide?
The canonical SMILES for 4-(2,4-dihydroxyphenyl)-N-(3-fluorophenyl)piperidine-1-carboxamide is O=C(Nc1cccc(F)c1)N1CCC(c2ccc(O)cc2O)CC1.
What is the InChIKey of 4-(2,4-dihydroxyphenyl)-N-(3-fluorophenyl)piperidine-1-carboxamide?
The InChIKey is VEOFCJYACUJIQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19FN2O3/c19-13-2-1-3-14(10-13)20-18(24)21-8-6-12(7-9-21)16-5-4-15(22)11-17(16)23/h1-5,10-12,22-23H,6-9H2,(H,20,24).
What are the key properties of 4-(2,4-dihydroxyphenyl)-N-(3-fluorophenyl)piperidine-1-carboxamide?
4-(2,4-dihydroxyphenyl)-N-(3-fluorophenyl)piperidine-1-carboxamide has a molecular weight of 330.36 g/mol, XLogP of 3.65, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dihydroxyphenyl)-N-(3-fluorophenyl)piperidine-1-carboxamide is sourced from PubChem (CID 46214377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).