About 2-phenylprop-1-ene-1,1,3-tricarbonitrile
2-phenylprop-1-ene-1,1,3-tricarbonitrile (PubChem CID 4621440) has the molecular formula C12H7N3
and a molecular weight of 193.21 g/mol. Its IUPAC name is 2-phenylprop-1-ene-1,1,3-tricarbonitrile.
Molecular Properties
| Compound Name | 2-phenylprop-1-ene-1,1,3-tricarbonitrile |
| PubChem CID | 4621440 |
| Molecular Formula | C12H7N3 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 2-phenylprop-1-ene-1,1,3-tricarbonitrile |
| SMILES | N#CCC(=C(C#N)C#N)c1ccccc1 |
| InChI | InChI=1S/C12H7N3/c13-7-6-12(11(8-14)9-15)10-4-2-1-3-5-10/h1-5H,6H2 |
| InChIKey | OKGPOSFUSLYERN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylprop-1-ene-1,1,3-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylprop-1-ene-1,1,3-tricarbonitrile?
The IUPAC name of 2-phenylprop-1-ene-1,1,3-tricarbonitrile (CID 4621440) is 2-phenylprop-1-ene-1,1,3-tricarbonitrile.
What is the SMILES notation for 2-phenylprop-1-ene-1,1,3-tricarbonitrile?
The canonical SMILES for 2-phenylprop-1-ene-1,1,3-tricarbonitrile is N#CCC(=C(C#N)C#N)c1ccccc1.
What is the InChIKey of 2-phenylprop-1-ene-1,1,3-tricarbonitrile?
The InChIKey is OKGPOSFUSLYERN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7N3/c13-7-6-12(11(8-14)9-15)10-4-2-1-3-5-10/h1-5H,6H2.
What are the key properties of 2-phenylprop-1-ene-1,1,3-tricarbonitrile?
2-phenylprop-1-ene-1,1,3-tricarbonitrile has a molecular weight of 193.21 g/mol, XLogP of 2.40, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylprop-1-ene-1,1,3-tricarbonitrile is sourced from PubChem (CID 4621440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).