About methyl 4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]benzoate
methyl 4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]benzoate (PubChem CID 46214541) has the molecular formula C26H19N3O3S
and a molecular weight of 453.52 g/mol. Its IUPAC name is methyl 4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]benzoate |
| PubChem CID | 46214541 |
| Molecular Formula | C26H19N3O3S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | methyl 4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cccnc2Oc2ccc(Nc3nc4ccccc4s3)cc2)cc1 |
| InChI | InChI=1S/C26H19N3O3S/c1-31-25(30)18-10-8-17(9-11-18)21-5-4-16-27-24(21)32-20-14-12-19(13-15-20)28-26-29-22-6-2-3-7-23(22)33-26/h2-16H,1H3,(H,28,29) |
| InChIKey | PWXFIXPKUHAHRO-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]benzoate?
The IUPAC name of methyl 4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]benzoate (CID 46214541) is methyl 4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]benzoate.
What is the SMILES notation for methyl 4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]benzoate?
The canonical SMILES for methyl 4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]benzoate is COC(=O)c1ccc(-c2cccnc2Oc2ccc(Nc3nc4ccccc4s3)cc2)cc1.
What is the InChIKey of methyl 4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]benzoate?
The InChIKey is PWXFIXPKUHAHRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H19N3O3S/c1-31-25(30)18-10-8-17(9-11-18)21-5-4-16-27-24(21)32-20-14-12-19(13-15-20)28-26-29-22-6-2-3-7-23(22)33-26/h2-16H,1H3,(H,28,29).
What are the key properties of methyl 4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]benzoate?
methyl 4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]benzoate has a molecular weight of 453.52 g/mol, XLogP of 6.68, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2-[4-(1,3-benzothiazol-2-ylamino)phenoxy]-3-pyridinyl]benzoate is sourced from PubChem (CID 46214541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).