C15H17N7O — CID 46214653
6-(2-amino-6-morpholin-4-ylpyrimidin-4-yl)-1H-indazol-3-amine (PubChem CID 46214653) has the molecular formula C15H17N7O and a molecular weight of 311.35 g/mol. Its IUPAC name is 6-(2-amino-6-morpholin-4-ylpyrimidin-4-yl)-1H-indazol-3-amine.
| Compound Name | 6-(2-amino-6-morpholin-4-ylpyrimidin-4-yl)-1H-indazol-3-amine |
|---|---|
| PubChem CID | 46214653 |
| Molecular Formula | C15H17N7O |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 6-(2-amino-6-morpholin-4-ylpyrimidin-4-yl)-1H-indazol-3-amine |
| SMILES | Nc1nc(-c2ccc3c(N)n[nH]c3c2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C15H17N7O/c16-14-10-2-1-9(7-12(10)20-21-14)11-8-13(19-15(17)18-11)22-3-5-23-6-4-22/h1-2,7-8H,3-6H2,(H3,16,20,21)(H2,17,18,19) |
| InChIKey | IBSXLFOFZRSWEZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |