C11H23N5O — CID 46214702
N-(diaminomethylidene)-2-pentan-3-ylmorpholine-4-carboximidamide (PubChem CID 46214702) has the molecular formula C11H23N5O and a molecular weight of 241.34 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-pentan-3-ylmorpholine-4-carboximidamide.
| Compound Name | N-(diaminomethylidene)-2-pentan-3-ylmorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 46214702 |
| Molecular Formula | C11H23N5O |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | N-(diaminomethylidene)-2-pentan-3-ylmorpholine-4-carboximidamide |
| SMILES | [H]/N=C(\N=C(N)N)N1CCOC(C(CC)CC)C1 |
| InChI | InChI=1S/C11H23N5O/c1-3-8(4-2)9-7-16(5-6-17-9)11(14)15-10(12)13/h8-9H,3-7H2,1-2H3,(H5,12,13,14,15) |
| InChIKey | CDFZKJJINNBKAF-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|