About 2,3-dioctyloxirane
2,3-dioctyloxirane (PubChem CID 4621500) has the molecular formula C18H36O
and a molecular weight of 268.48 g/mol. Its IUPAC name is 2,3-dioctyloxirane.
Molecular Properties
| Compound Name | 2,3-dioctyloxirane |
| PubChem CID | 4621500 |
| Molecular Formula | C18H36O |
| Molecular Weight | 268.48 g/mol |
| Exact Mass | 268.28 |
| IUPAC Name | 2,3-dioctyloxirane |
| SMILES | CCCCCCCCC1OC1CCCCCCCC |
| InChI | InChI=1S/C18H36O/c1-3-5-7-9-11-13-15-17-18(19-17)16-14-12-10-8-6-4-2/h17-18H,3-16H2,1-2H3 |
| InChIKey | WAEWJBWJSRGWFY-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.48 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dioctyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dioctyloxirane?
The IUPAC name of 2,3-dioctyloxirane (CID 4621500) is 2,3-dioctyloxirane.
What is the SMILES notation for 2,3-dioctyloxirane?
The canonical SMILES for 2,3-dioctyloxirane is CCCCCCCCC1OC1CCCCCCCC.
What is the InChIKey of 2,3-dioctyloxirane?
The InChIKey is WAEWJBWJSRGWFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O/c1-3-5-7-9-11-13-15-17-18(19-17)16-14-12-10-8-6-4-2/h17-18H,3-16H2,1-2H3.
What are the key properties of 2,3-dioctyloxirane?
2,3-dioctyloxirane has a molecular weight of 268.48 g/mol, XLogP of 6.26, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dioctyloxirane is sourced from PubChem (CID 4621500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).