C30H31F3N4O2 — CID 46215515
(4S,9E)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4-(3,4,5-trifluorophenyl)spiro[4,6,7,8-tetrahydropyrido[2,1-c][1,2,4]oxadiazine-3,1'-cyclohexane] (PubChem CID 46215515) has the molecular formula C30H31F3N4O2 and a molecular weight of 536.60 g/mol. Its IUPAC name is (4S,9E)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4-(3,4,5-trifluorophenyl)spiro[4,6,7,8-tetrahydropyrido[2,1-c][1,2,4]oxadiazine-3,1'-cyclohexane].
| Compound Name | (4S,9E)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4-(3,4,5-trifluorophenyl)spiro[4,6,7,8-tetrahydropyrido[2,1-c][1,2,4]oxadiazine-3,1'-cyclohexane] |
|---|---|
| PubChem CID | 46215515 |
| Molecular Formula | C30H31F3N4O2 |
| Molecular Weight | 536.60 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | (4S,9E)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4-(3,4,5-trifluorophenyl)spiro[4,6,7,8-tetrahydropyrido[2,1-c][1,2,4]oxadiazine-3,1'-cyclohexane] |
| SMILES | COc1cc(/C=C2\CCCN3C2=NOC2(CCCCC2)[C@@H]3c2cc(F)c(F)c(F)c2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C30H31F3N4O2/c1-19-17-36(18-34-19)25-9-8-20(14-26(25)38-2)13-21-7-6-12-37-28(22-15-23(31)27(33)24(32)16-22)30(39-35-29(21)37)10-4-3-5-11-30/h8-9,13-18,28H,3-7,10-12H2,1-2H3/b21-13+/t28-/m0/s1 |
| InChIKey | QQLMSQUFYRFQIL-PPOGSYTESA-N |
| XLogP | 6.87 |
| TPSA | 51.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.60 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|