C31H29F3N4O2 — CID 46216031
(5S)-3-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-6-phenyl-4-propyl-5-(3,4,5-trifluorophenyl)-5,6-dihydro-1,2,4-oxadiazine (PubChem CID 46216031) has the molecular formula C31H29F3N4O2 and a molecular weight of 546.59 g/mol. Its IUPAC name is (5S)-3-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-6-phenyl-4-propyl-5-(3,4,5-trifluorophenyl)-5,6-dihydro-1,2,4-oxadiazine.
| Compound Name | (5S)-3-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-6-phenyl-4-propyl-5-(3,4,5-trifluorophenyl)-5,6-dihydro-1,2,4-oxadiazine |
|---|---|
| PubChem CID | 46216031 |
| Molecular Formula | C31H29F3N4O2 |
| Molecular Weight | 546.59 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | (5S)-3-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-6-phenyl-4-propyl-5-(3,4,5-trifluorophenyl)-5,6-dihydro-1,2,4-oxadiazine |
| SMILES | CCCN1C(/C=C/c2ccc(-n3cnc(C)c3)c(OC)c2)=NOC(c2ccccc2)[C@@H]1c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C31H29F3N4O2/c1-4-14-38-28(13-11-21-10-12-26(27(15-21)39-3)37-18-20(2)35-19-37)36-40-31(22-8-6-5-7-9-22)30(38)23-16-24(32)29(34)25(33)17-23/h5-13,15-19,30-31H,4,14H2,1-3H3/b13-11+/t30-,31?/m0/s1 |
| InChIKey | TXBYVOFDVMDNPB-MKLJBCMHSA-N |
| XLogP | 7.16 |
| TPSA | 51.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.59 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|