C20H25NO3 — CID 46216311
(3aS,6aR)-2-(2,6-diethyl-4-methylphenyl)-5-methoxyimino-3a,4,6,6a-tetrahydropentalene-1,3-dione (PubChem CID 46216311) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is (3aS,6aR)-2-(2,6-diethyl-4-methylphenyl)-5-methoxyimino-3a,4,6,6a-tetrahydropentalene-1,3-dione.
| Compound Name | (3aS,6aR)-2-(2,6-diethyl-4-methylphenyl)-5-methoxyimino-3a,4,6,6a-tetrahydropentalene-1,3-dione |
|---|---|
| PubChem CID | 46216311 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (3aS,6aR)-2-(2,6-diethyl-4-methylphenyl)-5-methoxyimino-3a,4,6,6a-tetrahydropentalene-1,3-dione |
| SMILES | CCc1cc(C)cc(CC)c1C1C(=O)[C@H]2C/C(=N/OC)C[C@H]2C1=O |
| InChI | InChI=1S/C20H25NO3/c1-5-12-7-11(3)8-13(6-2)17(12)18-19(22)15-9-14(21-24-4)10-16(15)20(18)23/h7-8,15-16,18H,5-6,9-10H2,1-4H3/b21-14-/t15-,16+,18?/m0/s1 |
| InChIKey | PLRKYXAGHOZLGE-BNCHMAJKSA-N |
| XLogP | 3.38 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|