C15H20F9NO4 — CID 46216400
ethyl 4,4,5,5,6,6,7,7,7-nonafluoro-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoate (PubChem CID 46216400) has the molecular formula C15H20F9NO4 and a molecular weight of 449.31 g/mol. Its IUPAC name is ethyl 4,4,5,5,6,6,7,7,7-nonafluoro-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoate.
| Compound Name | ethyl 4,4,5,5,6,6,7,7,7-nonafluoro-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoate |
|---|---|
| PubChem CID | 46216400 |
| Molecular Formula | C15H20F9NO4 |
| Molecular Weight | 449.31 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | ethyl 4,4,5,5,6,6,7,7,7-nonafluoro-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoate |
| SMILES | CCOC(=O)C(NC(=O)OC(C)(C)C)C(C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H20F9NO4/c1-6-28-9(26)8(25-10(27)29-11(3,4)5)7(2)12(16,17)13(18,19)14(20,21)15(22,23)24/h7-8H,6H2,1-5H3,(H,25,27) |
| InChIKey | QNEPCLYBMUVQHZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.31 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|