C23H29NO3 — CID 46216484
(3aS,6aR)-5-(cyclopropylmethoxyimino)-2-(2,6-diethyl-4-methylphenyl)-3a,4,6,6a-tetrahydropentalene-1,3-dione (PubChem CID 46216484) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is (3aS,6aR)-5-(cyclopropylmethoxyimino)-2-(2,6-diethyl-4-methylphenyl)-3a,4,6,6a-tetrahydropentalene-1,3-dione.
| Compound Name | (3aS,6aR)-5-(cyclopropylmethoxyimino)-2-(2,6-diethyl-4-methylphenyl)-3a,4,6,6a-tetrahydropentalene-1,3-dione |
|---|---|
| PubChem CID | 46216484 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (3aS,6aR)-5-(cyclopropylmethoxyimino)-2-(2,6-diethyl-4-methylphenyl)-3a,4,6,6a-tetrahydropentalene-1,3-dione |
| SMILES | CCc1cc(C)cc(CC)c1C1C(=O)[C@H]2C/C(=N/OCC3CC3)C[C@H]2C1=O |
| InChI | InChI=1S/C23H29NO3/c1-4-15-8-13(3)9-16(5-2)20(15)21-22(25)18-10-17(11-19(18)23(21)26)24-27-12-14-6-7-14/h8-9,14,18-19,21H,4-7,10-12H2,1-3H3/b24-17-/t18-,19+,21?/m0/s1 |
| InChIKey | TUNACXTVAXWPLD-QTROIYFNSA-N |
| XLogP | 4.16 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|