C33H35ClN4O3 — CID 46216734
2-[5-[(2R,5S)-4-benzhydryl-2,5-dimethylpiperazine-1-carbonyl]-6-chloro-1-methylindol-3-yl]-N,N-dimethyl-2-oxoacetamide (PubChem CID 46216734) has the molecular formula C33H35ClN4O3 and a molecular weight of 571.12 g/mol. Its IUPAC name is 2-[5-[(2R,5S)-4-benzhydryl-2,5-dimethylpiperazine-1-carbonyl]-6-chloro-1-methylindol-3-yl]-N,N-dimethyl-2-oxoacetamide.
| Compound Name | 2-[5-[(2R,5S)-4-benzhydryl-2,5-dimethylpiperazine-1-carbonyl]-6-chloro-1-methylindol-3-yl]-N,N-dimethyl-2-oxoacetamide |
|---|---|
| PubChem CID | 46216734 |
| Molecular Formula | C33H35ClN4O3 |
| Molecular Weight | 571.12 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | 2-[5-[(2R,5S)-4-benzhydryl-2,5-dimethylpiperazine-1-carbonyl]-6-chloro-1-methylindol-3-yl]-N,N-dimethyl-2-oxoacetamide |
| SMILES | C[C@@H]1CN(C(c2ccccc2)c2ccccc2)[C@@H](C)CN1C(=O)c1cc2c(C(=O)C(=O)N(C)C)cn(C)c2cc1Cl |
| InChI | InChI=1S/C33H35ClN4O3/c1-21-19-38(22(2)18-37(21)30(23-12-8-6-9-13-23)24-14-10-7-11-15-24)32(40)26-16-25-27(31(39)33(41)35(3)4)20-36(5)29(25)17-28(26)34/h6-17,20-22,30H,18-19H2,1-5H3/t21-,22+/m0/s1 |
| InChIKey | HIAKXKGKRDVPMY-FCHUYYIVSA-N |
| XLogP | 5.43 |
| TPSA | 65.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.12 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|