C20H15F6N3O2 — CID 46216790
2-[4-[2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxyethylamino]phenyl]-1,3-benzoxazole-5-carbonitrile (PubChem CID 46216790) has the molecular formula C20H15F6N3O2 and a molecular weight of 443.35 g/mol. Its IUPAC name is 2-[4-[2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxyethylamino]phenyl]-1,3-benzoxazole-5-carbonitrile.
| Compound Name | 2-[4-[2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxyethylamino]phenyl]-1,3-benzoxazole-5-carbonitrile |
|---|---|
| PubChem CID | 46216790 |
| Molecular Formula | C20H15F6N3O2 |
| Molecular Weight | 443.35 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 2-[4-[2-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxyethylamino]phenyl]-1,3-benzoxazole-5-carbonitrile |
| SMILES | CC(OCCNc1ccc(-c2nc3cc(C#N)ccc3o2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H15F6N3O2/c1-18(19(21,22)23,20(24,25)26)30-9-8-28-14-5-3-13(4-6-14)17-29-15-10-12(11-27)2-7-16(15)31-17/h2-7,10,28H,8-9H2,1H3 |
| InChIKey | TUQWAKHRTDVQCD-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.35 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|