C24H44O3Si — CID 46216956
3-[(1S,4R,4aR,8aR)-1,8a-dimethyl-5-methylidene-4-triethylsilyloxy-2,3,4,6,7,8-hexahydro-1H-naphthalen-4a-yl]propyl acetate (PubChem CID 46216956) has the molecular formula C24H44O3Si and a molecular weight of 408.70 g/mol. Its IUPAC name is 3-[(1S,4R,4aR,8aR)-1,8a-dimethyl-5-methylidene-4-triethylsilyloxy-2,3,4,6,7,8-hexahydro-1H-naphthalen-4a-yl]propyl acetate.
| Compound Name | 3-[(1S,4R,4aR,8aR)-1,8a-dimethyl-5-methylidene-4-triethylsilyloxy-2,3,4,6,7,8-hexahydro-1H-naphthalen-4a-yl]propyl acetate |
|---|---|
| PubChem CID | 46216956 |
| Molecular Formula | C24H44O3Si |
| Molecular Weight | 408.70 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | 3-[(1S,4R,4aR,8aR)-1,8a-dimethyl-5-methylidene-4-triethylsilyloxy-2,3,4,6,7,8-hexahydro-1H-naphthalen-4a-yl]propyl acetate |
| SMILES | C=C1CCC[C@]2(C)[C@@H](C)CC[C@@H](O[Si](CC)(CC)CC)[C@]12CCCOC(C)=O |
| InChI | InChI=1S/C24H44O3Si/c1-8-28(9-2,10-3)27-22-15-14-19(4)23(7)16-11-13-20(5)24(22,23)17-12-18-26-21(6)25/h19,22H,5,8-18H2,1-4,6-7H3/t19-,22+,23+,24-/m0/s1 |
| InChIKey | OHTPSMJUTFRAHA-QVGHQYEOSA-N |
| XLogP | 6.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.70 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|