C26H27N3O2 — CID 4621708
4-(9-ethoxy-2-phenyl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl)-N,N-dimethylaniline (PubChem CID 4621708) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is 4-(9-ethoxy-2-phenyl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl)-N,N-dimethylaniline.
| Compound Name | 4-(9-ethoxy-2-phenyl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 4621708 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 4-(9-ethoxy-2-phenyl-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl)-N,N-dimethylaniline |
| SMILES | CCOc1ccc2c(c1)C1CC(c3ccccc3)=NN1C(c1ccc(N(C)C)cc1)O2 |
| InChI | InChI=1S/C26H27N3O2/c1-4-30-21-14-15-25-22(16-21)24-17-23(18-8-6-5-7-9-18)27-29(24)26(31-25)19-10-12-20(13-11-19)28(2)3/h5-16,24,26H,4,17H2,1-3H3 |
| InChIKey | HEFQRGCNDQPLNT-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|