C10H21NO3 — CID 46217227
ethyl (2S,3R)-3-hydroxy-2-(2-methylpropylamino)butanoate (PubChem CID 46217227) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is ethyl (2S,3R)-3-hydroxy-2-(2-methylpropylamino)butanoate.
| Compound Name | ethyl (2S,3R)-3-hydroxy-2-(2-methylpropylamino)butanoate |
|---|---|
| PubChem CID | 46217227 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | ethyl (2S,3R)-3-hydroxy-2-(2-methylpropylamino)butanoate |
| SMILES | CCOC(=O)[C@@H](NCC(C)C)[C@@H](C)O |
| InChI | InChI=1S/C10H21NO3/c1-5-14-10(13)9(8(4)12)11-6-7(2)3/h7-9,11-12H,5-6H2,1-4H3/t8-,9+/m1/s1 |
| InChIKey | IYMOEKQJKIKNJI-BDAKNGLRSA-N |
| XLogP | 0.54 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |