C10H16O3 — CID 46217723
(1R,4R,5R,6R,8R)-4,6,8-trimethyl-2,9-dioxabicyclo[3.3.1]nonan-3-one (PubChem CID 46217723) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is (1R,4R,5R,6R,8R)-4,6,8-trimethyl-2,9-dioxabicyclo[3.3.1]nonan-3-one.
| Compound Name | (1R,4R,5R,6R,8R)-4,6,8-trimethyl-2,9-dioxabicyclo[3.3.1]nonan-3-one |
|---|---|
| PubChem CID | 46217723 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (1R,4R,5R,6R,8R)-4,6,8-trimethyl-2,9-dioxabicyclo[3.3.1]nonan-3-one |
| SMILES | C[C@@H]1C[C@@H](C)[C@H]2O[C@@H]1OC(=O)[C@@H]2C |
| InChI | InChI=1S/C10H16O3/c1-5-4-6(2)10-12-8(5)7(3)9(11)13-10/h5-8,10H,4H2,1-3H3/t5-,6-,7-,8-,10-/m1/s1 |
| InChIKey | SROGXPUGWPBIFO-VRRGKTLJSA-N |
| XLogP | 1.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |