C11H6BrF9O — CID 46217842
1-(4-bromophenyl)-2,2,3,3,4,4,5,5,5-nonafluoropentan-1-ol (PubChem CID 46217842) has the molecular formula C11H6BrF9O and a molecular weight of 405.05 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2,2,3,3,4,4,5,5,5-nonafluoropentan-1-ol.
| Compound Name | 1-(4-bromophenyl)-2,2,3,3,4,4,5,5,5-nonafluoropentan-1-ol |
|---|---|
| PubChem CID | 46217842 |
| Molecular Formula | C11H6BrF9O |
| Molecular Weight | 405.05 g/mol |
| Exact Mass | 403.95 |
| IUPAC Name | 1-(4-bromophenyl)-2,2,3,3,4,4,5,5,5-nonafluoropentan-1-ol |
| SMILES | OC(c1ccc(Br)cc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H6BrF9O/c12-6-3-1-5(2-4-6)7(22)8(13,14)9(15,16)10(17,18)11(19,20)21/h1-4,7,22H |
| InChIKey | ZEVIVKGHJDBGBM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.05 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|