C15H17ClO3 — CID 46217882
(3aR,3bR,5S,6aR)-1-chloro-3a,5-dimethyl-3-methylidene-2-oxo-4,6,6a,7-tetrahydro-3bH-cyclopenta[a]pentalene-5-carboxylic acid (PubChem CID 46217882) has the molecular formula C15H17ClO3 and a molecular weight of 280.75 g/mol. Its IUPAC name is (3aR,3bR,5S,6aR)-1-chloro-3a,5-dimethyl-3-methylidene-2-oxo-4,6,6a,7-tetrahydro-3bH-cyclopenta[a]pentalene-5-carboxylic acid.
| Compound Name | (3aR,3bR,5S,6aR)-1-chloro-3a,5-dimethyl-3-methylidene-2-oxo-4,6,6a,7-tetrahydro-3bH-cyclopenta[a]pentalene-5-carboxylic acid |
|---|---|
| PubChem CID | 46217882 |
| Molecular Formula | C15H17ClO3 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (3aR,3bR,5S,6aR)-1-chloro-3a,5-dimethyl-3-methylidene-2-oxo-4,6,6a,7-tetrahydro-3bH-cyclopenta[a]pentalene-5-carboxylic acid |
| SMILES | C=C1C(=O)C(Cl)=C2C[C@H]3C[C@](C)(C(=O)O)C[C@H]3[C@]12C |
| InChI | InChI=1S/C15H17ClO3/c1-7-12(17)11(16)9-4-8-5-14(2,13(18)19)6-10(8)15(7,9)3/h8,10H,1,4-6H2,2-3H3,(H,18,19)/t8-,10+,14-,15+/m0/s1 |
| InChIKey | KUFNUUMXIJNLKX-LLQQRXHISA-N |
| XLogP | 3.15 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|