C14H19BrO — CID 46217912
(2R,3S)-2-(4-bromophenyl)-3-ethyl-3-methylpent-4-en-2-ol (PubChem CID 46217912) has the molecular formula C14H19BrO and a molecular weight of 283.21 g/mol. Its IUPAC name is (2R,3S)-2-(4-bromophenyl)-3-ethyl-3-methylpent-4-en-2-ol.
| Compound Name | (2R,3S)-2-(4-bromophenyl)-3-ethyl-3-methylpent-4-en-2-ol |
|---|---|
| PubChem CID | 46217912 |
| Molecular Formula | C14H19BrO |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | (2R,3S)-2-(4-bromophenyl)-3-ethyl-3-methylpent-4-en-2-ol |
| SMILES | C=C[C@](C)(CC)[C@@](C)(O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H19BrO/c1-5-13(3,6-2)14(4,16)11-7-9-12(15)10-8-11/h5,7-10,16H,1,6H2,2-4H3/t13-,14+/m1/s1 |
| InChIKey | WZSVPYBYHZGQML-KGLIPLIRSA-N |
| XLogP | 4.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|