C15H28O3 — CID 46217966
2-[(3R,3aR,5S,8R,8aS)-8-hydroxy-3,8-dimethyl-2,3,3a,4,5,6,7,8a-octahydro-1H-azulen-5-yl]propane-1,2-diol (PubChem CID 46217966) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-[(3R,3aR,5S,8R,8aS)-8-hydroxy-3,8-dimethyl-2,3,3a,4,5,6,7,8a-octahydro-1H-azulen-5-yl]propane-1,2-diol.
| Compound Name | 2-[(3R,3aR,5S,8R,8aS)-8-hydroxy-3,8-dimethyl-2,3,3a,4,5,6,7,8a-octahydro-1H-azulen-5-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 46217966 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 2-[(3R,3aR,5S,8R,8aS)-8-hydroxy-3,8-dimethyl-2,3,3a,4,5,6,7,8a-octahydro-1H-azulen-5-yl]propane-1,2-diol |
| SMILES | C[C@@H]1CC[C@H]2[C@@H]1C[C@@H](C(C)(O)CO)CC[C@@]2(C)O |
| InChI | InChI=1S/C15H28O3/c1-10-4-5-13-12(10)8-11(15(3,18)9-16)6-7-14(13,2)17/h10-13,16-18H,4-9H2,1-3H3/t10-,11+,12-,13+,14-,15?/m1/s1 |
| InChIKey | ZMKAVJLNYHOIQP-WQFUOLRDSA-N |
| XLogP | 1.94 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |