C17H20Cl2N2 — CID 4621800
N-[(2,4-dichlorophenyl)methylideneamino]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine (PubChem CID 4621800) has the molecular formula C17H20Cl2N2 and a molecular weight of 323.27 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methylideneamino]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine.
| Compound Name | N-[(2,4-dichlorophenyl)methylideneamino]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine |
|---|---|
| PubChem CID | 4621800 |
| Molecular Formula | C17H20Cl2N2 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methylideneamino]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-imine |
| SMILES | CC12CCC(CC1=NN=Cc1ccc(Cl)cc1Cl)C2(C)C |
| InChI | InChI=1S/C17H20Cl2N2/c1-16(2)12-6-7-17(16,3)15(8-12)21-20-10-11-4-5-13(18)9-14(11)19/h4-5,9-10,12H,6-8H2,1-3H3 |
| InChIKey | NAFPDVNYVQKEFO-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|