C16H24O6S — CID 46218132
[(2S,4R,6S)-4-(methoxymethoxy)-6-methyloxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 46218132) has the molecular formula C16H24O6S and a molecular weight of 344.43 g/mol. Its IUPAC name is [(2S,4R,6S)-4-(methoxymethoxy)-6-methyloxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,4R,6S)-4-(methoxymethoxy)-6-methyloxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 46218132 |
| Molecular Formula | C16H24O6S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | [(2S,4R,6S)-4-(methoxymethoxy)-6-methyloxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | COCO[C@H]1C[C@@H](COS(=O)(=O)c2ccc(C)cc2)O[C@@H](C)C1 |
| InChI | InChI=1S/C16H24O6S/c1-12-4-6-16(7-5-12)23(17,18)21-10-15-9-14(20-11-19-3)8-13(2)22-15/h4-7,13-15H,8-11H2,1-3H3/t13-,14+,15-/m0/s1 |
| InChIKey | GIGRHEPUKZSJFJ-ZNMIVQPWSA-N |
| XLogP | 2.26 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|