About tert-butyl-[(2S,4S)-4-(methoxymethoxy)hept-6-en-2-yl]oxy-dimethylsilane
tert-butyl-[(2S,4S)-4-(methoxymethoxy)hept-6-en-2-yl]oxy-dimethylsilane (PubChem CID 46218224) has the molecular formula C15H32O3Si
and a molecular weight of 288.50 g/mol. Its IUPAC name is tert-butyl-[(2S,4S)-4-(methoxymethoxy)hept-6-en-2-yl]oxy-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(2S,4S)-4-(methoxymethoxy)hept-6-en-2-yl]oxy-dimethylsilane |
| PubChem CID | 46218224 |
| Molecular Formula | C15H32O3Si |
| Molecular Weight | 288.50 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | tert-butyl-[(2S,4S)-4-(methoxymethoxy)hept-6-en-2-yl]oxy-dimethylsilane |
| SMILES | C=CC[C@@H](C[C@H](C)O[Si](C)(C)C(C)(C)C)OCOC |
| InChI | InChI=1S/C15H32O3Si/c1-9-10-14(17-12-16-6)11-13(2)18-19(7,8)15(3,4)5/h9,13-14H,1,10-12H2,2-8H3/t13-,14-/m0/s1 |
| InChIKey | DCLPIYGKABUWEZ-KBPBESRZSA-N |
| XLogP | 4.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(2S,4S)-4-(methoxymethoxy)hept-6-en-2-yl]oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(2S,4S)-4-(methoxymethoxy)hept-6-en-2-yl]oxy-dimethylsilane?
The IUPAC name of tert-butyl-[(2S,4S)-4-(methoxymethoxy)hept-6-en-2-yl]oxy-dimethylsilane (CID 46218224) is tert-butyl-[(2S,4S)-4-(methoxymethoxy)hept-6-en-2-yl]oxy-dimethylsilane.
What is the SMILES notation for tert-butyl-[(2S,4S)-4-(methoxymethoxy)hept-6-en-2-yl]oxy-dimethylsilane?
The canonical SMILES for tert-butyl-[(2S,4S)-4-(methoxymethoxy)hept-6-en-2-yl]oxy-dimethylsilane is C=CC[C@@H](C[C@H](C)O[Si](C)(C)C(C)(C)C)OCOC.
What is the InChIKey of tert-butyl-[(2S,4S)-4-(methoxymethoxy)hept-6-en-2-yl]oxy-dimethylsilane?
The InChIKey is DCLPIYGKABUWEZ-KBPBESRZSA-N. The full InChI is InChI=1S/C15H32O3Si/c1-9-10-14(17-12-16-6)11-13(2)18-19(7,8)15(3,4)5/h9,13-14H,1,10-12H2,2-8H3/t13-,14-/m0/s1.
What are the key properties of tert-butyl-[(2S,4S)-4-(methoxymethoxy)hept-6-en-2-yl]oxy-dimethylsilane?
tert-butyl-[(2S,4S)-4-(methoxymethoxy)hept-6-en-2-yl]oxy-dimethylsilane has a molecular weight of 288.50 g/mol, XLogP of 4.35, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(2S,4S)-4-(methoxymethoxy)hept-6-en-2-yl]oxy-dimethylsilane is sourced from PubChem (CID 46218224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).