C18H36O5Si — CID 46218226
ethyl (E,5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)oct-2-enoate (PubChem CID 46218226) has the molecular formula C18H36O5Si and a molecular weight of 360.57 g/mol. Its IUPAC name is ethyl (E,5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)oct-2-enoate.
| Compound Name | ethyl (E,5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)oct-2-enoate |
|---|---|
| PubChem CID | 46218226 |
| Molecular Formula | C18H36O5Si |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | ethyl (E,5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)oct-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@@H](C[C@H](C)O[Si](C)(C)C(C)(C)C)OCOC |
| InChI | InChI=1S/C18H36O5Si/c1-9-21-17(19)12-10-11-16(22-14-20-6)13-15(2)23-24(7,8)18(3,4)5/h10,12,15-16H,9,11,13-14H2,1-8H3/b12-10+/t15-,16-/m0/s1 |
| InChIKey | XPDANZACWCOERZ-VMNGNHSPSA-N |
| XLogP | 4.29 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|