C15H23FO2 — CID 46218278
(1R,4aS,8aS)-1-fluoro-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydronaphthalene-1-carboxylic acid (PubChem CID 46218278) has the molecular formula C15H23FO2 and a molecular weight of 254.34 g/mol. Its IUPAC name is (1R,4aS,8aS)-1-fluoro-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydronaphthalene-1-carboxylic acid.
| Compound Name | (1R,4aS,8aS)-1-fluoro-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydronaphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 46218278 |
| Molecular Formula | C15H23FO2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | (1R,4aS,8aS)-1-fluoro-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydronaphthalene-1-carboxylic acid |
| SMILES | C=C1CC[C@H]2C(C)(C)CCC[C@]2(C)[C@@]1(F)C(=O)O |
| InChI | InChI=1S/C15H23FO2/c1-10-6-7-11-13(2,3)8-5-9-14(11,4)15(10,16)12(17)18/h11H,1,5-9H2,2-4H3,(H,17,18)/t11-,14-,15-/m0/s1 |
| InChIKey | PWTKFVVPSBTZKP-CQDKDKBSSA-N |
| XLogP | 3.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|