C15H31N3OSi — CID 46218527
[(3R,4S)-4-azido-3-ethenyl-5-methylhexoxy]-tert-butyl-dimethylsilane (PubChem CID 46218527) has the molecular formula C15H31N3OSi and a molecular weight of 297.52 g/mol. Its IUPAC name is [(3R,4S)-4-azido-3-ethenyl-5-methylhexoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(3R,4S)-4-azido-3-ethenyl-5-methylhexoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 46218527 |
| Molecular Formula | C15H31N3OSi |
| Molecular Weight | 297.52 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | [(3R,4S)-4-azido-3-ethenyl-5-methylhexoxy]-tert-butyl-dimethylsilane |
| SMILES | C=C[C@@H](CCO[Si](C)(C)C(C)(C)C)[C@@H](N=[N+]=[N-])C(C)C |
| InChI | InChI=1S/C15H31N3OSi/c1-9-13(14(12(2)3)17-18-16)10-11-19-20(7,8)15(4,5)6/h9,12-14H,1,10-11H2,2-8H3/t13-,14-/m0/s1 |
| InChIKey | SVGVNTMKNADIKT-KBPBESRZSA-N |
| XLogP | 5.54 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.52 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|